Products 155266-44-7
CAS 155266-44-7 is the registry number for 3-(3-Methyl-2,6-dioxo-2,3,6,9-tetrahydro-1H-purin-1-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3-methyl-2,6-dioxo-7H-purin-1-yl)propanoic acid (CAS 155266-44-7) is a chemical compound with the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. IUPAC name: 3-(3-methyl-2,6-dioxo-7H-purin-1-yl)propanoic acid. InChIKey: POOCYGOJOAWODV-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O4 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 3-(3-methyl-2,6-dioxo-7H-purin-1-yl)propanoic acid |
| InChIKey | POOCYGOJOAWODV-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)CCC(=O)O)NC=N2 |
Computed by PubChem (NCBI)