Products 5614-56-2

CAS 5614-56-2 is the registry number for 2-(3,7-Dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid (CAS 5614-56-2) is a chemical compound with the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. IUPAC name: 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid. InChIKey: YCTSCXLOPJCPDH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N4O4
Molecular weight238.20 g/mol
IUPAC name2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid
InChIKeyYCTSCXLOPJCPDH-UHFFFAOYSA-N
SMILESCN1C=NC2=C1C(=O)N(C(=O)N2C)CC(=O)O

Computed by PubChem (NCBI)