CAS 5614-56-2 is the registry number for 2-(3,7-Dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid (CAS 5614-56-2) is a chemical compound with the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. IUPAC name: 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid. InChIKey: YCTSCXLOPJCPDH-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O4 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid |
| InChIKey | YCTSCXLOPJCPDH-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=O)N(C(=O)N2C)CC(=O)O |
Computed by PubChem (NCBI)