Products 2633725-62-7
CAS 2633725-62-7 is the registry number for 2-(4-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)-1H-pyrazol-1-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(2,4-dioxo-1,3-diazinan-1-yl)pyrazol-1-yl]acetic acid (CAS 2633725-62-7) is a chemical compound with the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. IUPAC name: 2-[4-(2,4-dioxo-1,3-diazinan-1-yl)pyrazol-1-yl]acetic acid. InChIKey: MPOAGOUKZAWJCA-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O4 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 2-[4-(2,4-dioxo-1,3-diazinan-1-yl)pyrazol-1-yl]acetic acid |
| InChIKey | MPOAGOUKZAWJCA-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CN(N=C2)CC(=O)O |
Computed by PubChem (NCBI)