CAS 1567-89-1 appears in our catalog under these names: Acetone 2,4-Dinitrophenylhydrazone, >95% (HPLC), Acetone-2,4-dinitrophenylhydrazone, Acetone-2,4-dinitrophenylhydrazone 1000 µg/mL in Acetonitrile, Acetone 2,4–Dinitrophenylhydrazone, Acetone 2,4-Dinitrophenylhydrazone, >98.0%(HPLC). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 10g, 1g, 25mg, 1ml, 5g, 1EA, 50MG, 250mg.
2,4-dinitro-N-(propan-2-ylideneamino)aniline (CAS 1567-89-1) is a chemical compound with the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. IUPAC name: 2,4-dinitro-N-(propan-2-ylideneamino)aniline. InChIKey: YGIXYAIGWMAGIB-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O4 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 2,4-dinitro-N-(propan-2-ylideneamino)aniline |
| InChIKey | YGIXYAIGWMAGIB-UHFFFAOYSA-N |
| SMILES | CC(=NNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])C |
Computed by PubChem (NCBI)