CAS 395075-27-1 is the registry number for Acetone 2,4-Dinitrophenylhydrazone-13C3, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 50mg.
2,4-dinitro-N-((1,2,3-13C3)propan-2-ylideneamino)aniline (CAS 395075-27-1) is a chemical compound with the molecular formula C9H10N4O4 and a molecular weight of 241.18 g/mol. IUPAC name: 2,4-dinitro-N-((1,2,3-13C3)propan-2-ylideneamino)aniline. InChIKey: YGIXYAIGWMAGIB-LQAOFMTQSA-N.
| Molecular formula | C9H10N4O4 |
|---|---|
| Molecular weight | 241.18 g/mol |
| IUPAC name | 2,4-dinitro-N-((1,2,3-13C3)propan-2-ylideneamino)aniline |
| InChIKey | YGIXYAIGWMAGIB-LQAOFMTQSA-N |
| SMILES | [13CH3][13C](=NNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])[13CH3] |
Computed by PubChem (NCBI)