CAS 857228-20-7 appears in our catalog under these names: 3-(3-Methyl-2,6-dioxo-2,3,6,7-tetrahydro-1h-purin-8-yl)propanoic acid, 95%, 3-(3-Methyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)propanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.
3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanoic acid (CAS 857228-20-7) is a chemical compound with the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. IUPAC name: 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanoic acid. InChIKey: YHGZELDCUZIIRE-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O4 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanoic acid |
| InChIKey | YHGZELDCUZIIRE-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)NC1=O)NC(=N2)CCC(=O)O |
Computed by PubChem (NCBI)