Products 1553737-89-5

CAS 1553737-89-5 is the registry number for 2-Cyclopropyl-4-methylbenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-cyclopropyl-4-methylbenzoic acid (CAS 1553737-89-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 2-cyclopropyl-4-methylbenzoic acid. InChIKey: UXRCEBVNYDKBAC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O2
Molecular weight176.21 g/mol
IUPAC name2-cyclopropyl-4-methylbenzoic acid
InChIKeyUXRCEBVNYDKBAC-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C(=O)O)C2CC2

Computed by PubChem (NCBI)