CAS 1555162-42-9 is the registry number for 2-(4-Bromophenyl)-1,3-thiazol-4-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4-bromophenyl)-1,3-thiazol-4-amine (CAS 1555162-42-9) is a chemical compound with the molecular formula C9H7BrN2S and a molecular weight of 255.14 g/mol. IUPAC name: 2-(4-bromophenyl)-1,3-thiazol-4-amine. InChIKey: CUEXOWOQJNGWHV-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2S |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,3-thiazol-4-amine |
| InChIKey | CUEXOWOQJNGWHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)N)Br |
Computed by PubChem (NCBI)