Products 1557551-63-9

CAS 1557551-63-9 is the registry number for 2-(4-Cyclopropyl-5-thioxo-4,5-dihydro-1H-1,2,4-triazol-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)acetic acid (CAS 1557551-63-9) is a chemical compound with the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. IUPAC name: 2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)acetic acid. InChIKey: GLVVXEVKYAAVOD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9N3O2S
Molecular weight199.23 g/mol
IUPAC name2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)acetic acid
InChIKeyGLVVXEVKYAAVOD-UHFFFAOYSA-N
SMILESC1CC1N2C(=NNC2=S)CC(=O)O

Computed by PubChem (NCBI)