CAS 39978-26-2 appears in our catalog under these names: N–((Hydrazinecarbonyl)methyl)thiophene–2–carboxamide, N-((Hydrazinecarbonyl)methyl)thiophene-2-carboxamide, N-((Hydrazinecarbonyl)methyl)thiophene-2-carboxamide, 95%. Offered by: GLPBio, Biosynth, AmBeed. Available pack sizes: 100mg, 2,5g, 250mg, 5g.
N-(2-hydrazinyl-2-oxoethyl)thiophene-2-carboxamide (CAS 39978-26-2) is a chemical compound with the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. IUPAC name: N-(2-hydrazinyl-2-oxoethyl)thiophene-2-carboxamide. InChIKey: HGCJMJNFNMTOJX-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | N-(2-hydrazinyl-2-oxoethyl)thiophene-2-carboxamide |
| InChIKey | HGCJMJNFNMTOJX-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)NCC(=O)NN |
Computed by PubChem (NCBI)