CAS 223571-79-7 is the registry number for 4-Ethynyl-N,N-dimethyl-1H-imidazole-1-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethynyl-N,N-dimethylimidazole-1-sulfonamide (CAS 223571-79-7) is a chemical compound with the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. IUPAC name: 4-ethynyl-N,N-dimethylimidazole-1-sulfonamide. InChIKey: XYNDOCMVCVYADB-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 4-ethynyl-N,N-dimethylimidazole-1-sulfonamide |
| InChIKey | XYNDOCMVCVYADB-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C=C(N=C1)C#C |
Computed by PubChem (NCBI)