CAS 2845127-14-0 appears in our catalog under these names: 3-(Cyclopropylsulfonyl)pyrazin-2-amine, 98%, 3-(Cyclopropylsulfonyl)pyrazin-2-amine 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: 250mg, 50mg, 100mg, 1g.
3-cyclopropylsulfonylpyrazin-2-amine (CAS 2845127-14-0) is a chemical compound with the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. IUPAC name: 3-cyclopropylsulfonylpyrazin-2-amine. InChIKey: BVBXEBHRKGKZAR-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 3-cyclopropylsulfonylpyrazin-2-amine |
| InChIKey | BVBXEBHRKGKZAR-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)C2=NC=CN=C2N |
Computed by PubChem (NCBI)