CAS 2761953-67-5 is the registry number for 5-Cyclopropyl-3-(methylsulfonyl)-1,2,4-triazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-cyclopropyl-3-methylsulfonyl-1,2,4-triazine (CAS 2761953-67-5) is a chemical compound with the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. IUPAC name: 5-cyclopropyl-3-methylsulfonyl-1,2,4-triazine. InChIKey: MSONFFPVXMPVHV-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 5-cyclopropyl-3-methylsulfonyl-1,2,4-triazine |
| InChIKey | MSONFFPVXMPVHV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC(=CN=N1)C2CC2 |
Computed by PubChem (NCBI)