CAS 160758-18-9 appears in our catalog under these names: 1-((5-Mercapto-1,3,4-oxadiazol-2-yl)methyl)pyrrolidin-2-one, 98%, 1-((5-Sulfanyl-1,3,4-oxadiazol-2-yl)methyl)pyrrolidin-2-one. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2,5g, 250mg.
1-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methyl]pyrrolidin-2-one (CAS 160758-18-9) is a chemical compound with the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. IUPAC name: 1-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methyl]pyrrolidin-2-one. InChIKey: KEFULOLFGBVEJN-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 1-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methyl]pyrrolidin-2-one |
| InChIKey | KEFULOLFGBVEJN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)CC2=NNC(=S)O2 |
Computed by PubChem (NCBI)