CAS 155814-17-8 is the registry number for (E)-3-(2,5-Dimethylphenyl)acrylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
(E)-3-(2,5-dimethylphenyl)prop-2-enoic acid (CAS 155814-17-8) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (E)-3-(2,5-dimethylphenyl)prop-2-enoic acid. InChIKey: FAIBVLSPNAHVSQ-AATRIKPKSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (E)-3-(2,5-dimethylphenyl)prop-2-enoic acid |
| InChIKey | FAIBVLSPNAHVSQ-AATRIKPKSA-N |
| SMILES | CC1=CC(=C(C=C1)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)