CAS 155874-22-9 appears in our catalog under these names: Cephalomannine Impurity 8, (3R,4S)-2-Oxo-3-oxhydryl-4-phenyl-1-boc-azetidine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Tert-butyl (3R,4S)-3-hydroxy-2-oxo-4-phenylazetidine-1-carboxylate (CAS 155874-22-9) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: tert-butyl (3R,4S)-3-hydroxy-2-oxo-4-phenylazetidine-1-carboxylate. InChIKey: HEPUXLWZYXEISX-WDEREUQCSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-hydroxy-2-oxo-4-phenylazetidine-1-carboxylate |
| InChIKey | HEPUXLWZYXEISX-WDEREUQCSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]([C@H](C1=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)