CAS 15601-44-2 is the registry number for 4-(4-Chlorobenzylidene)-2-phenyloxazol-5(4H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4Z)-4-[(4-chlorophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one (CAS 15601-44-2) is a chemical compound with the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. IUPAC name: (4Z)-4-[(4-chlorophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one. InChIKey: PKMDOGQJFLVZEJ-UVTDQMKNSA-N.
| Molecular formula | C16H10ClNO2 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | (4Z)-4-[(4-chlorophenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
| InChIKey | PKMDOGQJFLVZEJ-UVTDQMKNSA-N |
| SMILES | C1=CC=C(C=C1)C2=N/C(=C\C3=CC=C(C=C3)Cl)/C(=O)O2 |
Computed by PubChem (NCBI)