CAS 89242-09-1 appears in our catalog under these names: 1-(2-Chlorophenyl)isoquinoline-3-carboxylic acid, 97%, 1-(2-CHLOROPHENYL)ISOQUINOLINE-3-CARBOXYLIC ACID, 95%, 1-(2-Chlorophenyl)isoquinoline-3-carboxylic acid, 98%, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
1-(2-chlorophenyl)isoquinoline-3-carboxylic acid (CAS 89242-09-1) is a chemical compound with the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. IUPAC name: 1-(2-chlorophenyl)isoquinoline-3-carboxylic acid. InChIKey: JBRVJPXJLHEUND-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO2 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 1-(2-chlorophenyl)isoquinoline-3-carboxylic acid |
| InChIKey | JBRVJPXJLHEUND-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N=C2C3=CC=CC=C3Cl)C(=O)O |
Computed by PubChem (NCBI)