CAS 6633-62-1 is the registry number for 6-Chloro-2-phenylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-chloro-2-phenylquinoline-4-carboxylic acid (CAS 6633-62-1) is a chemical compound with the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. IUPAC name: 6-chloro-2-phenylquinoline-4-carboxylic acid. InChIKey: GSNVKXDNFUTEFY-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO2 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 6-chloro-2-phenylquinoline-4-carboxylic acid |
| InChIKey | GSNVKXDNFUTEFY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)Cl)C(=C2)C(=O)O |
Computed by PubChem (NCBI)