CAS 1075185-80-6 is the registry number for 2-(Benzo(d)(1,3)dioxol-5-yl)-6-chloroquinoline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
2-(1,3-benzodioxol-5-yl)-6-chloroquinoline (CAS 1075185-80-6) is a chemical compound with the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-6-chloroquinoline. InChIKey: CIMCVZMGHZXFIF-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO2 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-6-chloroquinoline |
| InChIKey | CIMCVZMGHZXFIF-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NC4=C(C=C3)C=C(C=C4)Cl |
Computed by PubChem (NCBI)