Products 20389-09-7

CAS 20389-09-7 is the registry number for 2-(2-Chlorophenyl)-4-quinolinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(2-chlorophenyl)quinoline-4-carboxylic acid (CAS 20389-09-7) is a chemical compound with the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. IUPAC name: 2-(2-chlorophenyl)quinoline-4-carboxylic acid. InChIKey: QBRGQUCIJZKQAY-UHFFFAOYSA-N.

Identity
Molecular formulaC16H10ClNO2
Molecular weight283.71 g/mol
IUPAC name2-(2-chlorophenyl)quinoline-4-carboxylic acid
InChIKeyQBRGQUCIJZKQAY-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CC(=N2)C3=CC=CC=C3Cl)C(=O)O

Computed by PubChem (NCBI)