CAS 5466-31-9 appears in our catalog under these names: 2-(4-Chloro-phenyl)-quinoline-4-carboxylic acid, 97%, 2-(4-Chloro-phenyl)-quinoline-4-carboxylic acid, 95%+, 95%+. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(4-chlorophenyl)quinoline-4-carboxylic acid (CAS 5466-31-9) is a chemical compound with the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. IUPAC name: 2-(4-chlorophenyl)quinoline-4-carboxylic acid. InChIKey: FTEWYGPKBUSJTI-UHFFFAOYSA-N.
| Molecular formula | C16H10ClNO2 |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 2-(4-chlorophenyl)quinoline-4-carboxylic acid |
| InChIKey | FTEWYGPKBUSJTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)