Products 1562519-83-8
CAS 1562519-83-8 is the registry number for 2-Cyano-3-(quinolin-2-yl)acrylic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-cyano-3-quinolin-2-ylprop-2-enoic acid (CAS 1562519-83-8) is a chemical compound with the molecular formula C13H8N2O2 and a molecular weight of 224.21 g/mol. IUPAC name: 2-cyano-3-quinolin-2-ylprop-2-enoic acid. InChIKey: SUTCOXUHKDGRLD-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O2 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 2-cyano-3-quinolin-2-ylprop-2-enoic acid |
| InChIKey | SUTCOXUHKDGRLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C=C(C#N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-cyano-3-quinolin-2-ylprop-2-enoic acid