CAS 1562995-49-6 is the registry number for Methyl 2-chloro-6-vinylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-chloro-6-ethenylbenzoate (CAS 1562995-49-6) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: methyl 2-chloro-6-ethenylbenzoate. InChIKey: MXDDCSHWAVDSPO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | methyl 2-chloro-6-ethenylbenzoate |
| InChIKey | MXDDCSHWAVDSPO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1Cl)C=C |
Computed by PubChem (NCBI)