CAS 156522-14-4 is the registry number for Methyl 3-amino-4-methanesulfonamidobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 3-amino-4-(methanesulfonamido)benzoate (CAS 156522-14-4) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: methyl 3-amino-4-(methanesulfonamido)benzoate. InChIKey: MTLCCRWPHSHUDL-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | methyl 3-amino-4-(methanesulfonamido)benzoate |
| InChIKey | MTLCCRWPHSHUDL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)NS(=O)(=O)C)N |
Computed by PubChem (NCBI)