CAS 1565461-42-8 is the registry number for 5,7-Dichloro-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5,7-dichloro-3H-quinazolin-4-one (CAS 1565461-42-8) is a chemical compound with the molecular formula C8H4Cl2N2O and a molecular weight of 215.03 g/mol. IUPAC name: 5,7-dichloro-3H-quinazolin-4-one. InChIKey: MGKJHFHUSYYJRP-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 5,7-dichloro-3H-quinazolin-4-one |
| InChIKey | MGKJHFHUSYYJRP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=CNC2=O)Cl)Cl |
Computed by PubChem (NCBI)