Products 1567114-12-8
CAS 1567114-12-8 is the registry number for 2,2-Difluoro-1-(2,3,4-trifluorophenyl)ethan-1-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,2-difluoro-1-(2,3,4-trifluorophenyl)ethanone (CAS 1567114-12-8) is a chemical compound with the molecular formula C8H3F5O and a molecular weight of 210.10 g/mol. IUPAC name: 2,2-difluoro-1-(2,3,4-trifluorophenyl)ethanone. InChIKey: ABDDCUNADYQOMQ-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 2,2-difluoro-1-(2,3,4-trifluorophenyl)ethanone |
| InChIKey | ABDDCUNADYQOMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)C(F)F)F)F)F |
Computed by PubChem (NCBI)