Products 197312-58-6
CAS 197312-58-6 is the registry number for 1-(4-(2,2-Difluorovinyl)phenyl)ethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
1-[4-(2,2-difluoroethenyl)phenyl]ethanone (CAS 197312-58-6) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: 1-[4-(2,2-difluoroethenyl)phenyl]ethanone. InChIKey: QGVQEHFBDWAJTO-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 1-[4-(2,2-difluoroethenyl)phenyl]ethanone |
| InChIKey | QGVQEHFBDWAJTO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C=C(F)F |
Computed by PubChem (NCBI)