Products 157226-77-2
CAS 157226-77-2 is the registry number for rel-1-(1,1-Dimethylethyl) 3,5-dimethyl (3R,5R)-1,3,5-piperidinetricarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-O-tert-butyl 3-O,5-O-dimethyl (3R,5R)-piperidine-1,3,5-tricarboxylate (CAS 157226-77-2) is a chemical compound with the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O,5-O-dimethyl (3R,5R)-piperidine-1,3,5-tricarboxylate. InChIKey: MIZBOYNXOLJHQY-NXEZZACHSA-N.
| Molecular formula | C14H23NO6 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O,5-O-dimethyl (3R,5R)-piperidine-1,3,5-tricarboxylate |
| InChIKey | MIZBOYNXOLJHQY-NXEZZACHSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H](C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)