CAS 157380-76-2 appears in our catalog under these names: (2R,3R,4R)-3-(Benzyloxy)-2-(hydroxymethyl)-3,4-dihydro-2H-pyran-4-ol, 97%, 4-O-Benzyl-D-galactal. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 100mg, 50mg.
(2R,3R,4R)-2-(hydroxymethyl)-3-phenylmethoxy-3,4-dihydro-2H-pyran-4-ol (CAS 157380-76-2) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: (2R,3R,4R)-2-(hydroxymethyl)-3-phenylmethoxy-3,4-dihydro-2H-pyran-4-ol. InChIKey: OIWQZGBSQDJVJN-JHJVBQTASA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (2R,3R,4R)-2-(hydroxymethyl)-3-phenylmethoxy-3,4-dihydro-2H-pyran-4-ol |
| InChIKey | OIWQZGBSQDJVJN-JHJVBQTASA-N |
| SMILES | C1=CC=C(C=C1)CO[C@@H]2[C@@H](C=CO[C@@H]2CO)O |
Computed by PubChem (NCBI)