CAS 58871-11-7 appears in our catalog under these names: 4-O-Benzyl-d-glucal, 95%, 4-O-Benzyl-D-glucal, 97% , 4-O-Benzyl-D-glucal, ≥98%, ≥98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 250mg, 1g.
(2R,3S,4R)-2-(hydroxymethyl)-3-phenylmethoxy-3,4-dihydro-2H-pyran-4-ol (CAS 58871-11-7) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: (2R,3S,4R)-2-(hydroxymethyl)-3-phenylmethoxy-3,4-dihydro-2H-pyran-4-ol. InChIKey: OIWQZGBSQDJVJN-UPJWGTAASA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | (2R,3S,4R)-2-(hydroxymethyl)-3-phenylmethoxy-3,4-dihydro-2H-pyran-4-ol |
| InChIKey | OIWQZGBSQDJVJN-UPJWGTAASA-N |
| SMILES | C1=CC=C(C=C1)CO[C@H]2[C@@H](C=CO[C@@H]2CO)O |
Computed by PubChem (NCBI)