Products 157383-41-0
CAS 157383-41-0 is the registry number for 3-(Dimethylamino)-5-(trifluoromethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(dimethylamino)-5-(trifluoromethyl)benzoic acid (CAS 157383-41-0) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: 3-(dimethylamino)-5-(trifluoromethyl)benzoic acid. InChIKey: QAUQTALSQIJXNX-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 3-(dimethylamino)-5-(trifluoromethyl)benzoic acid |
| InChIKey | QAUQTALSQIJXNX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=CC(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)