Products 157893-14-6
CAS 157893-14-6 appears in our catalog under these names: 3–Bromo–5–methoxybenzoic acid, 3-Bromo-5-methoxybenzoic acid, 98% , 3-Bromo-5-methoxybenzoic acid, 3-Bromo-5-methoxybenzoic acid 97%, 3-Bromo-5-methoxybenzoic acid, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 50g, 250mg, 100g.
3-bromo-5-methoxybenzoic acid (CAS 157893-14-6) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 3-bromo-5-methoxybenzoic acid. InChIKey: DMXJBCHYVUGXEH-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 3-bromo-5-methoxybenzoic acid |
| InChIKey | DMXJBCHYVUGXEH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)