CAS 696627-31-3 appears in our catalog under these names: 5-(3,4-Dimethoxyphenyl)-2-methyl-3-furoic acid, 95%, 5-(3,4-Dimethoxyphenyl)-2-methylfuran-3-carboxylic acid, 97%, 97%, 5-(3,4-dimethoxyphenyl)-2-methyl-3-furoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-(3,4-dimethoxyphenyl)-2-methylfuran-3-carboxylic acid (CAS 696627-31-3) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-2-methylfuran-3-carboxylic acid. InChIKey: YTSJMYAIZUSBCF-UHFFFAOYSA-N.
| Molecular formula | C14H14O5 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-2-methylfuran-3-carboxylic acid |
| InChIKey | YTSJMYAIZUSBCF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)C2=CC(=C(C=C2)OC)OC)C(=O)O |
Computed by PubChem (NCBI)