Products 304896-86-4

CAS 304896-86-4 is the registry number for [(2-Oxo-4-propyl-2h-chromen-7-yl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2-oxo-4-propylchromen-7-yl)oxyacetic acid (CAS 304896-86-4) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: 2-(2-oxo-4-propylchromen-7-yl)oxyacetic acid. InChIKey: QIDUPXBFHWESTC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O5
Molecular weight262.26 g/mol
IUPAC name2-(2-oxo-4-propylchromen-7-yl)oxyacetic acid
InChIKeyQIDUPXBFHWESTC-UHFFFAOYSA-N
SMILESCCCC1=CC(=O)OC2=C1C=CC(=C2)OCC(=O)O

Computed by PubChem (NCBI)