Products 158264-18-7

CAS 158264-18-7 is the registry number for 2-(1H-Pyrazol-1-yl)butanedioic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-pyrazol-1-ylbutanedioic acid (CAS 158264-18-7) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 2-pyrazol-1-ylbutanedioic acid. InChIKey: XZPAPEJWLAYNON-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O4
Molecular weight184.15 g/mol
IUPAC name2-pyrazol-1-ylbutanedioic acid
InChIKeyXZPAPEJWLAYNON-UHFFFAOYSA-N
SMILESC1=CN(N=C1)C(CC(=O)O)C(=O)O

Computed by PubChem (NCBI)