CAS 15865-94-8 is the registry number for 4,5-Dimethyl-N-phenylthiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dimethyl-N-phenyl-1,3-thiazol-2-amine (CAS 15865-94-8) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 4,5-dimethyl-N-phenyl-1,3-thiazol-2-amine. InChIKey: VEUBKVMWGDELMW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 4,5-dimethyl-N-phenyl-1,3-thiazol-2-amine |
| InChIKey | VEUBKVMWGDELMW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC2=CC=CC=C2)C |
Computed by PubChem (NCBI)