Products 1588298-00-3
CAS 1588298-00-3 is the registry number for 4-(AMINOMETHYL)-N-(3-METHOXYPHENYL)BENZAMIDE HYDROCHLORIDE, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(aminomethyl)-N-(3-methoxyphenyl)benzamide;hydrochloride (CAS 1588298-00-3) is a chemical compound with the molecular formula C15H17ClN2O2 and a molecular weight of 292.76 g/mol. IUPAC name: 4-(aminomethyl)-N-(3-methoxyphenyl)benzamide;hydrochloride. InChIKey: JKUKJQQJHUKNPE-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O2 |
|---|---|
| Molecular weight | 292.76 g/mol |
| IUPAC name | 4-(aminomethyl)-N-(3-methoxyphenyl)benzamide;hydrochloride |
| InChIKey | JKUKJQQJHUKNPE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NC(=O)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)