CAS 158839-52-2 appears in our catalog under these names: 2-(Hydroxy(pyridin-2-yl)methyl)phenol, Picosulfate Impurity 28, Picosulfate Impurity 5. Offered by: TRC, Chemat Brand. Available pack sizes: 250mg, on request.
2-[hydroxy(pyridin-2-yl)methyl]phenol (CAS 158839-52-2) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2-[hydroxy(pyridin-2-yl)methyl]phenol. InChIKey: UJBCSLLVFWVCGI-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2-[hydroxy(pyridin-2-yl)methyl]phenol |
| InChIKey | UJBCSLLVFWVCGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C2=CC=CC=N2)O)O |
Computed by PubChem (NCBI)