Products 159143-14-3
CAS 159143-14-3 appears in our catalog under these names: 4-(2-Amino-2-oxoethoxy)benzoic acid, 95%, 4-(2-Amino-2-oxoethoxy)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 250mg, 1g, 5g.
4-(2-amino-2-oxoethoxy)benzoic acid (CAS 159143-14-3) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 4-(2-amino-2-oxoethoxy)benzoic acid. InChIKey: AWIPPDRFNWTGTR-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 4-(2-amino-2-oxoethoxy)benzoic acid |
| InChIKey | AWIPPDRFNWTGTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OCC(=O)N |
Computed by PubChem (NCBI)