CAS 1592996-39-8 is the registry number for 5-Amino-2-chloroquinazolin-4(1H)-one. Offered by: TRC. Available pack sizes: 5g.
5-amino-2-chloro-3H-quinazolin-4-one (CAS 1592996-39-8) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 5-amino-2-chloro-3H-quinazolin-4-one. InChIKey: HRCOTVYHYCRXHQ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 5-amino-2-chloro-3H-quinazolin-4-one |
| InChIKey | HRCOTVYHYCRXHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)N=C(NC2=O)Cl)N |
Computed by PubChem (NCBI)