CAS 15931-25-6 appears in our catalog under these names: 3-Methoxy-2-methyl-4-nitropyridine 1-oxide, 98%, Pantoprazole Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
3-methoxy-2-methyl-4-nitro-1-oxidopyridin-1-ium (CAS 15931-25-6) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 3-methoxy-2-methyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: UTOYOMYYDAWZBO-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 3-methoxy-2-methyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | UTOYOMYYDAWZBO-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=CC(=C1OC)[N+](=O)[O-])[O-] |
Computed by PubChem (NCBI)