Products 15945-25-2
CAS 15945-25-2 appears in our catalog under these names: 2-Chloro-3-Nitrobenzenesulfonyl Chloride, 98%, 98%, 2-CHLORO-3-NITROBENZENE-1-SULFONYL CHLORIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-chloro-3-nitrobenzenesulfonyl chloride (CAS 15945-25-2) is a chemical compound with the molecular formula C6H3Cl2NO4S and a molecular weight of 256.06 g/mol. IUPAC name: 2-chloro-3-nitrobenzenesulfonyl chloride. InChIKey: XVHPRYPYHDUEAH-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO4S |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 2-chloro-3-nitrobenzenesulfonyl chloride |
| InChIKey | XVHPRYPYHDUEAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S(=O)(=O)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)