CAS 1594880-66-6 is the registry number for (E)-4-(3-Oxo-3-(3,4,5-trimethoxyphenyl)prop-1-en-1-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzoic acid (CAS 1594880-66-6) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: 4-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzoic acid. InChIKey: QSFJHQPTHBCRMP-RMKNXTFCSA-N.
| Molecular formula | C19H18O6 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 4-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]benzoic acid |
| InChIKey | QSFJHQPTHBCRMP-RMKNXTFCSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)/C=C/C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)