CAS 17892-41-0 is the registry number for 4-(3,4-Dimethoxyphenyl)-6,7-dimethoxy-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,4-dimethoxyphenyl)-6,7-dimethoxychromen-2-one (CAS 17892-41-0) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-6,7-dimethoxychromen-2-one. InChIKey: YFUBTNKPGZXQFK-UHFFFAOYSA-N.
| Molecular formula | C19H18O6 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-6,7-dimethoxychromen-2-one |
| InChIKey | YFUBTNKPGZXQFK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)OC3=CC(=C(C=C23)OC)OC)OC |
Computed by PubChem (NCBI)