Products 2157461-13-5
CAS 2157461-13-5 is the registry number for 3'-(tert-Butyl)-5'-formyl-4'-hydroxy-[1,1'-biphenyl]-3,5-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3-tert-butyl-5-formyl-4-hydroxyphenyl)benzene-1,3-dicarboxylic acid (CAS 2157461-13-5) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: 5-(3-tert-butyl-5-formyl-4-hydroxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: ADOFVMULNVTEHE-UHFFFAOYSA-N.
| Molecular formula | C19H18O6 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 5-(3-tert-butyl-5-formyl-4-hydroxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | ADOFVMULNVTEHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C=O)C2=CC(=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)