Products 35676-02-9

CAS 35676-02-9 is the registry number for 2,3,6,7-Tetramethoxy-9-phenanthrenecarboxylic Acid. Offered by: TRC. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2,3,6,7-tetramethoxyphenanthrene-9-carboxylic acid (CAS 35676-02-9) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: 2,3,6,7-tetramethoxyphenanthrene-9-carboxylic acid. InChIKey: ITKYSTASQAVAQK-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18O6
Molecular weight342.3 g/mol
IUPAC name2,3,6,7-tetramethoxyphenanthrene-9-carboxylic acid
InChIKeyITKYSTASQAVAQK-UHFFFAOYSA-N
SMILESCOC1=CC2=CC(=C3C=C(C(=CC3=C2C=C1OC)OC)OC)C(=O)O

Computed by PubChem (NCBI)