CAS 855-97-0 appears in our catalog under these names: 3',4',5,7-Tetramethoxyflavone, 97% , 3',4',5,7-Tetramethoxyflavone, 95%, 5,7,3',4'-Tetramethoxyflavone/ 99.33% (existing batch purity), 3',4',5,7-Tetramethoxyflavone, 5,7,3',4'-Tetramethoxyflavone 98%. Offered by: Thermo Scientific (Alfa Aesar), Combi-blocks, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 500mg, 250mg, 5mg, 10mg, 25mg, 50mg, 1g.
2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one (CAS 855-97-0) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one. InChIKey: CLXVBVLQKLQNRQ-UHFFFAOYSA-N.
| Molecular formula | C19H18O6 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one |
| InChIKey | CLXVBVLQKLQNRQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3OC)OC)OC |
Computed by PubChem (NCBI)