Products 21601-90-1

CAS 21601-90-1 is the registry number for Ipratropium Bromide Impurity 48. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2-ethoxy-2-oxo-1-phenylethoxy)-3-oxo-2-phenylpropanoic acid (CAS 21601-90-1) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: 3-(2-ethoxy-2-oxo-1-phenylethoxy)-3-oxo-2-phenylpropanoic acid. InChIKey: UWLUYCHNIISQSO-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18O6
Molecular weight342.3 g/mol
IUPAC name3-(2-ethoxy-2-oxo-1-phenylethoxy)-3-oxo-2-phenylpropanoic acid
InChIKeyUWLUYCHNIISQSO-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=CC=CC=C1)OC(=O)C(C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)