Products 159496-13-6
CAS 159496-13-6 appears in our catalog under these names: Adenosine-13C5, Adenosine-13C5, >95% (HPLC), Adenosine–13C5, 1', 2', 3', 4', 5'- ¹³C5-Adenosine, Adenosine-13C5, 99.35%, 99.35%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 100mg, 2,5mg, 25mg, 1mg, 10mg, 5mg, 2mg.
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolane-3,4-diol (CAS 159496-13-6) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 272.21 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolane-3,4-diol. InChIKey: OIRDTQYFTABQOQ-ANYWVTQQSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 272.21 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolane-3,4-diol |
| InChIKey | OIRDTQYFTABQOQ-ANYWVTQQSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[13C@H]3[13C@@H]([13C@@H]([13C@H](O3)[13CH2]O)O)O)N |
Computed by PubChem (NCBI)